You can:
Name | L-Amphetamine |
---|---|
Molecular formula | C9H13N |
IUPAC name | (2R)-1-phenylpropan-2-amine |
Molecular weight | 135.21 |
Hydrogen bond acceptor | 1 |
Hydrogen bond donor | 1 |
XlogP | 1.8 |
Synonyms | R(-)-Amphetamine (levo-Amphetamine), 1.0 mg/mL in methanol, ampule of 1 mL, certified reference material (-)-(R)-Amphetamine Hydrochloride (R)-a-Methyl-benzeneethanamine (R)-Amphetamine; Levamphetamine Benzeneethanamine, alpha-methyl-, (R)- [ Show all ] |
Inchi Key | KWTSXDURSIMDCE-MRVPVSSYSA-N |
Inchi ID | InChI=1S/C9H13N/c1-8(10)7-9-5-3-2-4-6-9/h2-6,8H,7,10H2,1H3/t8-/m1/s1 |
PubChem CID | 32893 |
ChEMBL | CHEMBL19393 |
IUPHAR | 2146 |
BindingDB | 50022721 |
DrugBank | N/A |
Structure | ![]() |
Lipinski's druglikeness | This ligand satisfies Lipinski's rule of five. |
You can:
GLASS ID | Name | UniProt | Gene | Species | Length |
---|---|---|---|---|---|
180136 | Trace amine-associated receptor 1 | Q923Y9 | Taar1 | Rattus norvegicus (Rat) | 332 |
180137 | Trace amine-associated receptor 1 | Q96RJ0 | TAAR1 | Homo sapiens (Human) | 339 |
180138 | Trace amine-associated receptor 1 | Q923Y8 | Taar1 | Mus musculus (Mouse) | 332 |
180139 | Trace amine-associated receptor 1 | Q8HZ64 | TAAR1 | Macaca mulatta (Rhesus macaque) | 338 |
zhanglabzhanggroup.org | +65-6601-1241 | Computing 1, 13 Computing Drive, Singapore 117417